C11H12F2N4O — CID 106414003
3,5-difluoro-1-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 106414003) has the molecular formula C11H12F2N4O and a molecular weight of 254.24 g/mol. Its IUPAC name is 3,5-difluoro-1-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106414003 |
| Molecular Formula | C11H12F2N4O |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3,5-difluoro-1-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | Cc1nc(CCNc2cc(F)cc(F)c2N)no1 |
| InChI | InChI=1S/C11H12F2N4O/c1-6-16-10(17-18-6)2-3-15-9-5-7(12)4-8(13)11(9)14/h4-5,15H,2-3,14H2,1H3 |
| InChIKey | CYXUZFYWZPVJDE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|