C11H9F2NS — CID 61074644
2,3-difluoro-N-(thiophen-3-ylmethyl)aniline (PubChem CID 61074644) has the molecular formula C11H9F2NS and a molecular weight of 225.26 g/mol. Its IUPAC name is 2,3-difluoro-N-(thiophen-3-ylmethyl)aniline.
| Compound Name | 2,3-difluoro-N-(thiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 61074644 |
| Molecular Formula | C11H9F2NS |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2,3-difluoro-N-(thiophen-3-ylmethyl)aniline |
| SMILES | Fc1cccc(NCc2ccsc2)c1F |
| InChI | InChI=1S/C11H9F2NS/c12-9-2-1-3-10(11(9)13)14-6-8-4-5-15-7-8/h1-5,7,14H,6H2 |
| InChIKey | ZOLHKIUYQUXBQP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |