C11H10F3N3O2S — CID 106379424
4-[[2-amino-5-(difluoromethoxy)-4-fluoroanilino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379424) has the molecular formula C11H10F3N3O2S and a molecular weight of 305.28 g/mol. Its IUPAC name is 4-[[2-amino-5-(difluoromethoxy)-4-fluoroanilino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-amino-5-(difluoromethoxy)-4-fluoroanilino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379424 |
| Molecular Formula | C11H10F3N3O2S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-[[2-amino-5-(difluoromethoxy)-4-fluoroanilino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Nc1cc(F)c(OC(F)F)cc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H10F3N3O2S/c12-6-1-7(15)8(2-9(6)19-10(13)14)16-3-5-4-20-11(18)17-5/h1-2,4,10,16H,3,15H2,(H,17,18) |
| InChIKey | UFOBUIPPBDXOTQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|