C13H18F3N3O2 — CID 106275375
3-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]-N,2,2-trimethylpropanamide (PubChem CID 106275375) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275375 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[2-amino-5-(difluoromethoxy)-4-fluoroanilino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNc1cc(OC(F)F)c(F)cc1N |
| InChI | InChI=1S/C13H18F3N3O2/c1-13(2,11(20)18-3)6-19-9-5-10(21-12(15)16)7(14)4-8(9)17/h4-5,12,19H,6,17H2,1-3H3,(H,18,20) |
| InChIKey | WOJYWYMYOCWVTB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|