C12H19FN4O2 — CID 83116533
2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)ethylurea (PubChem CID 83116533) has the molecular formula C12H19FN4O2 and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)ethylurea.
| Compound Name | 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)ethylurea |
|---|---|
| PubChem CID | 83116533 |
| Molecular Formula | C12H19FN4O2 |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)ethylurea |
| SMILES | CC(C)Oc1cc(NCCNC(N)=O)c(N)cc1F |
| InChI | InChI=1S/C12H19FN4O2/c1-7(2)19-11-6-10(9(14)5-8(11)13)16-3-4-17-12(15)18/h5-7,16H,3-4,14H2,1-2H3,(H3,15,17,18) |
| InChIKey | IVKMJBWXKCTTCF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|