C10H9ClFN3OS — CID 114181203
4-[(2-amino-4-chloro-5-fluoroanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181203) has the molecular formula C10H9ClFN3OS and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-[(2-amino-4-chloro-5-fluoroanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-amino-4-chloro-5-fluoroanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181203 |
| Molecular Formula | C10H9ClFN3OS |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 4-[(2-amino-4-chloro-5-fluoroanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | Nc1cc(Cl)c(F)cc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H9ClFN3OS/c11-6-1-8(13)9(2-7(6)12)14-3-5-4-17-10(16)15-5/h1-2,4,14H,3,13H2,(H,15,16) |
| InChIKey | ZCKBZCUMSDFLIO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|