C12H16N4O3S2 — CID 106379435
4-amino-N-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenesulfonamide (PubChem CID 106379435) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenesulfonamide.
| Compound Name | 4-amino-N-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106379435 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-amino-N-ethyl-3-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(NCc2csc(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-2-15-21(18,19)9-3-4-10(13)11(5-9)14-6-8-7-20-12(17)16-8/h3-5,7,14-15H,2,6,13H2,1H3,(H,16,17) |
| InChIKey | XFEXSEXOUYRITC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|