C12H20N4O3S — CID 82899334
2-[2-amino-5-(ethylsulfamoyl)anilino]-N-ethylacetamide (PubChem CID 82899334) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[2-amino-5-(ethylsulfamoyl)anilino]-N-ethylacetamide.
| Compound Name | 2-[2-amino-5-(ethylsulfamoyl)anilino]-N-ethylacetamide |
|---|---|
| PubChem CID | 82899334 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[2-amino-5-(ethylsulfamoyl)anilino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNc1cc(S(=O)(=O)NCC)ccc1N |
| InChI | InChI=1S/C12H20N4O3S/c1-3-14-12(17)8-15-11-7-9(5-6-10(11)13)20(18,19)16-4-2/h5-7,15-16H,3-4,8,13H2,1-2H3,(H,14,17) |
| InChIKey | OOTGCKFLNGAFMH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|