C10H15F2N3O2S — CID 82901311
4-amino-3-(2,2-difluoroethylamino)-N-ethylbenzenesulfonamide (PubChem CID 82901311) has the molecular formula C10H15F2N3O2S and a molecular weight of 279.31 g/mol. Its IUPAC name is 4-amino-3-(2,2-difluoroethylamino)-N-ethylbenzenesulfonamide.
| Compound Name | 4-amino-3-(2,2-difluoroethylamino)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82901311 |
| Molecular Formula | C10H15F2N3O2S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-amino-3-(2,2-difluoroethylamino)-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(NCC(F)F)c1 |
| InChI | InChI=1S/C10H15F2N3O2S/c1-2-15-18(16,17)7-3-4-8(13)9(5-7)14-6-10(11)12/h3-5,10,14-15H,2,6,13H2,1H3 |
| InChIKey | CGJQQECGWHRKCU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|