C12H21N3O3S — CID 82898095
4-amino-3-(2-ethoxyethylamino)-N-ethylbenzenesulfonamide (PubChem CID 82898095) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-amino-3-(2-ethoxyethylamino)-N-ethylbenzenesulfonamide.
| Compound Name | 4-amino-3-(2-ethoxyethylamino)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82898095 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-amino-3-(2-ethoxyethylamino)-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(NCCOCC)c1 |
| InChI | InChI=1S/C12H21N3O3S/c1-3-15-19(16,17)10-5-6-11(13)12(9-10)14-7-8-18-4-2/h5-6,9,14-15H,3-4,7-8,13H2,1-2H3 |
| InChIKey | NCVBRLSXBSKCLI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|