C12H14N2O3S2 — CID 106381991
4-[(4-ethylsulfonylanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381991) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[(4-ethylsulfonylanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(4-ethylsulfonylanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381991 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[(4-ethylsulfonylanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCS(=O)(=O)c1ccc(NCc2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-2-19(16,17)11-5-3-9(4-6-11)13-7-10-8-18-12(15)14-10/h3-6,8,13H,2,7H2,1H3,(H,14,15) |
| InChIKey | GKTQSEYLRIHFHO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |