C10H9ClFN3O3S2 — CID 106379297
3-amino-5-chloro-2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide (PubChem CID 106379297) has the molecular formula C10H9ClFN3O3S2 and a molecular weight of 337.79 g/mol. Its IUPAC name is 3-amino-5-chloro-2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106379297 |
| Molecular Formula | C10H9ClFN3O3S2 |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 3-amino-5-chloro-2-fluoro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NCc2csc(=O)[nH]2)c1F |
| InChI | InChI=1S/C10H9ClFN3O3S2/c11-5-1-7(13)9(12)8(2-5)20(17,18)14-3-6-4-19-10(16)15-6/h1-2,4,14H,3,13H2,(H,15,16) |
| InChIKey | PKAWKFVFBCQZDH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|