C9H8ClN3O3S2 — CID 103868103
2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 103868103) has the molecular formula C9H8ClN3O3S2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103868103 |
| Molecular Formula | C9H8ClN3O3S2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-chloro-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)c2cccnc2Cl)cs1 |
| InChI | InChI=1S/C9H8ClN3O3S2/c10-8-7(2-1-3-11-8)18(15,16)12-4-6-5-17-9(14)13-6/h1-3,5,12H,4H2,(H,13,14) |
| InChIKey | WILHPIWDPQAXRO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|