C10H8Br2N2O3S2 — CID 113341895
2,4-dibromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide (PubChem CID 113341895) has the molecular formula C10H8Br2N2O3S2 and a molecular weight of 428.13 g/mol. Its IUPAC name is 2,4-dibromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113341895 |
| Molecular Formula | C10H8Br2N2O3S2 |
| Molecular Weight | 428.13 g/mol |
| Exact Mass | 425.83 |
| IUPAC Name | 2,4-dibromo-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=c1[nH]c(CNS(=O)(=O)c2ccc(Br)cc2Br)cs1 |
| InChI | InChI=1S/C10H8Br2N2O3S2/c11-6-1-2-9(8(12)3-6)19(16,17)13-4-7-5-18-10(15)14-7/h1-3,5,13H,4H2,(H,14,15) |
| InChIKey | JCQUTAWXNPXYOS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |