C11H8Br3NO2S2 — CID 47319560
2,4-dibromo-N-[(4-bromothiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 47319560) has the molecular formula C11H8Br3NO2S2 and a molecular weight of 490.04 g/mol. Its IUPAC name is 2,4-dibromo-N-[(4-bromothiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[(4-bromothiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 47319560 |
| Molecular Formula | C11H8Br3NO2S2 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 486.75 |
| IUPAC Name | 2,4-dibromo-N-[(4-bromothiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(Br)cs1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H8Br3NO2S2/c12-7-1-2-11(10(14)4-7)19(16,17)15-5-9-3-8(13)6-18-9/h1-4,6,15H,5H2 |
| InChIKey | DSPBXUFVXIAUEL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |