C8H7Br2NO4S — CID 60823111
2-[(2,4-dibromophenyl)sulfonylamino]acetic acid (PubChem CID 60823111) has the molecular formula C8H7Br2NO4S and a molecular weight of 373.02 g/mol. Its IUPAC name is 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 60823111 |
| Molecular Formula | C8H7Br2NO4S |
| Molecular Weight | 373.02 g/mol |
| Exact Mass | 370.85 |
| IUPAC Name | 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C8H7Br2NO4S/c9-5-1-2-7(6(10)3-5)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | HWCBGJLTOZRLHS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.02 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |