2-[(2,4-dibromophenyl)sulfonylamino]acetic acid

C8H7Br2NO4S — CID 60823111

IUPAC2-[(2,4-dibromophenyl)sulfonylamino]acetic acid
SMILESO=C(O)CNS(=O)(=O)c1ccc(Br)cc1Br
InChIInChI=1S/C8H7Br2NO4S/c9-5-1-2-7(6(10)3-5)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13)
InChIKeyHWCBGJLTOZRLHS-UHFFFAOYSA-N
MW373.02 g/mol
LogP1.57
Rot. Bonds4

About 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid

2-[(2,4-dibromophenyl)sulfonylamino]acetic acid (PubChem CID 60823111) has the molecular formula C8H7Br2NO4S and a molecular weight of 373.02 g/mol. Its IUPAC name is 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid.

Molecular Properties

Compound Name2-[(2,4-dibromophenyl)sulfonylamino]acetic acid
PubChem CID60823111
Molecular FormulaC8H7Br2NO4S
Molecular Weight373.02 g/mol
Exact Mass370.85
IUPAC Name2-[(2,4-dibromophenyl)sulfonylamino]acetic acid
SMILESO=C(O)CNS(=O)(=O)c1ccc(Br)cc1Br
InChIInChI=1S/C8H7Br2NO4S/c9-5-1-2-7(6(10)3-5)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13)
InChIKeyHWCBGJLTOZRLHS-UHFFFAOYSA-N
XLogP1.57
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.02
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid?
The IUPAC name of 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid (CID 60823111) is 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid.
What is the SMILES notation for 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid?
The canonical SMILES for 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid is O=C(O)CNS(=O)(=O)c1ccc(Br)cc1Br.
What is the InChIKey of 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid?
The InChIKey is HWCBGJLTOZRLHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2NO4S/c9-5-1-2-7(6(10)3-5)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13).
What are the key properties of 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid?
2-[(2,4-dibromophenyl)sulfonylamino]acetic acid has a molecular weight of 373.02 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dibromophenyl)sulfonylamino]acetic acid is sourced from PubChem (CID 60823111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).