C8H10BrN3O3S — CID 43255728
2-[(4-amino-2-bromophenyl)sulfonylamino]acetamide (PubChem CID 43255728) has the molecular formula C8H10BrN3O3S and a molecular weight of 308.16 g/mol. Its IUPAC name is 2-[(4-amino-2-bromophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-amino-2-bromophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 43255728 |
| Molecular Formula | C8H10BrN3O3S |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 2-[(4-amino-2-bromophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(N)cc1Br |
| InChI | InChI=1S/C8H10BrN3O3S/c9-6-3-5(10)1-2-7(6)16(14,15)12-4-8(11)13/h1-3,12H,4,10H2,(H2,11,13) |
| InChIKey | ZRVCDBXOYPWZIT-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|