C8H11N3O3S — CID 3678127
2-[(4-aminophenyl)sulfonylamino]acetamide (PubChem CID 3678127) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 3678127 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H11N3O3S/c9-6-1-3-7(4-2-6)15(13,14)11-5-8(10)12/h1-4,11H,5,9H2,(H2,10,12) |
| InChIKey | CUVOCAYVRNBSQZ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|