C9H9N3O3S — CID 4844985
2-[(4-cyanophenyl)sulfonylamino]acetamide (PubChem CID 4844985) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4844985 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonylamino]acetamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C9H9N3O3S/c10-5-7-1-3-8(4-2-7)16(14,15)12-6-9(11)13/h1-4,12H,6H2,(H2,11,13) |
| InChIKey | UPUTXYVUUHGZLR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |