C8H9Br2N3O3S — CID 43257086
2-[(4-amino-2,6-dibromophenyl)sulfonylamino]acetamide (PubChem CID 43257086) has the molecular formula C8H9Br2N3O3S and a molecular weight of 387.05 g/mol. Its IUPAC name is 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 43257086 |
| Molecular Formula | C8H9Br2N3O3S |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 384.87 |
| IUPAC Name | 2-[(4-amino-2,6-dibromophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C8H9Br2N3O3S/c9-5-1-4(11)2-6(10)8(5)17(15,16)13-3-7(12)14/h1-2,13H,3,11H2,(H2,12,14) |
| InChIKey | CYXOLDXGPQOAFY-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|