C11H10Br2N4O2S — CID 106894707
4-amino-2,6-dibromo-N-(pyridazin-3-ylmethyl)benzenesulfonamide (PubChem CID 106894707) has the molecular formula C11H10Br2N4O2S and a molecular weight of 422.10 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-(pyridazin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106894707 |
| Molecular Formula | C11H10Br2N4O2S |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 419.89 |
| IUPAC Name | 4-amino-2,6-dibromo-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)c(S(=O)(=O)NCc2cccnn2)c(Br)c1 |
| InChI | InChI=1S/C11H10Br2N4O2S/c12-9-4-7(14)5-10(13)11(9)20(18,19)16-6-8-2-1-3-15-17-8/h1-5,16H,6,14H2 |
| InChIKey | UODPXERNELNUDM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|