C10H10BrN3O2S2 — CID 106833688
5-bromo-2-methyl-N-(pyridazin-3-ylmethyl)thiophene-3-sulfonamide (PubChem CID 106833688) has the molecular formula C10H10BrN3O2S2 and a molecular weight of 348.25 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(pyridazin-3-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(pyridazin-3-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106833688 |
| Molecular Formula | C10H10BrN3O2S2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 5-bromo-2-methyl-N-(pyridazin-3-ylmethyl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NCc1cccnn1 |
| InChI | InChI=1S/C10H10BrN3O2S2/c1-7-9(5-10(11)17-7)18(15,16)13-6-8-3-2-4-12-14-8/h2-5,13H,6H2,1H3 |
| InChIKey | GXZABYYHDNKDSA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |