C12H11Br2N3O2S — CID 106833668
2,5-dibromo-4-methyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide (PubChem CID 106833668) has the molecular formula C12H11Br2N3O2S and a molecular weight of 421.11 g/mol. Its IUPAC name is 2,5-dibromo-4-methyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-4-methyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106833668 |
| Molecular Formula | C12H11Br2N3O2S |
| Molecular Weight | 421.11 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | 2,5-dibromo-4-methyl-N-(pyridazin-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(S(=O)(=O)NCc2cccnn2)cc1Br |
| InChI | InChI=1S/C12H11Br2N3O2S/c1-8-5-11(14)12(6-10(8)13)20(18,19)16-7-9-3-2-4-15-17-9/h2-6,16H,7H2,1H3 |
| InChIKey | WRLYBQAOWRDWFX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |