C14H13Br2NO2S — CID 50876820
N-benzyl-2,4-dibromo-5-methylbenzenesulfonamide (PubChem CID 50876820) has the molecular formula C14H13Br2NO2S and a molecular weight of 419.14 g/mol. Its IUPAC name is N-benzyl-2,4-dibromo-5-methylbenzenesulfonamide.
| Compound Name | N-benzyl-2,4-dibromo-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 50876820 |
| Molecular Formula | C14H13Br2NO2S |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | N-benzyl-2,4-dibromo-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCc2ccccc2)c(Br)cc1Br |
| InChI | InChI=1S/C14H13Br2NO2S/c1-10-7-14(13(16)8-12(10)15)20(18,19)17-9-11-5-3-2-4-6-11/h2-8,17H,9H2,1H3 |
| InChIKey | QQZXWOFUHGPFQU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |