C16H18BrNO2S — CID 91669643
4-bromo-2,5-dimethyl-N-[(4-methylphenyl)methyl]benzenesulfonamide (PubChem CID 91669643) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 4-bromo-2,5-dimethyl-N-[(4-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,5-dimethyl-N-[(4-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91669643 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-bromo-2,5-dimethyl-N-[(4-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2cc(C)c(Br)cc2C)cc1 |
| InChI | InChI=1S/C16H18BrNO2S/c1-11-4-6-14(7-5-11)10-18-21(19,20)16-9-12(2)15(17)8-13(16)3/h4-9,18H,10H2,1-3H3 |
| InChIKey | IOONZNZRFTUFED-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |