C11H16Br2N2O3S — CID 104758524
4-amino-2,6-dibromo-N-(2-methoxy-2-methylpropyl)benzenesulfonamide (PubChem CID 104758524) has the molecular formula C11H16Br2N2O3S and a molecular weight of 416.14 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-(2-methoxy-2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-(2-methoxy-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104758524 |
| Molecular Formula | C11H16Br2N2O3S |
| Molecular Weight | 416.14 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 4-amino-2,6-dibromo-N-(2-methoxy-2-methylpropyl)benzenesulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C11H16Br2N2O3S/c1-11(2,18-3)6-15-19(16,17)10-8(12)4-7(14)5-9(10)13/h4-5,15H,6,14H2,1-3H3 |
| InChIKey | YGSJIXZTZCFUED-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.14 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|