C10H10Br2N2O2S — CID 113464460
4-amino-2,6-dibromo-N-but-2-ynylbenzenesulfonamide (PubChem CID 113464460) has the molecular formula C10H10Br2N2O2S and a molecular weight of 382.08 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-but-2-ynylbenzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-but-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 113464460 |
| Molecular Formula | C10H10Br2N2O2S |
| Molecular Weight | 382.08 g/mol |
| Exact Mass | 379.88 |
| IUPAC Name | 4-amino-2,6-dibromo-N-but-2-ynylbenzenesulfonamide |
| SMILES | CC#CCNS(=O)(=O)c1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C10H10Br2N2O2S/c1-2-3-4-14-17(15,16)10-8(11)5-7(13)6-9(10)12/h5-6,14H,4,13H2,1H3 |
| InChIKey | IRNAZBFBRCJCAV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|