C12H16Br2N2O2S2 — CID 80725860
4-amino-2,6-dibromo-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide (PubChem CID 80725860) has the molecular formula C12H16Br2N2O2S2 and a molecular weight of 444.21 g/mol. Its IUPAC name is 4-amino-2,6-dibromo-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-dibromo-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 80725860 |
| Molecular Formula | C12H16Br2N2O2S2 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 441.90 |
| IUPAC Name | 4-amino-2,6-dibromo-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2c(Br)cc(N)cc2Br)CCCS1 |
| InChI | InChI=1S/C12H16Br2N2O2S2/c1-12(3-2-4-19-12)7-16-20(17,18)11-9(13)5-8(15)6-10(11)14/h5-6,16H,2-4,7,15H2,1H3 |
| InChIKey | IQTZNCVGYCMJIX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|