C12H16BrFN2O2S2 — CID 80726436
5-amino-3-bromo-2-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide (PubChem CID 80726436) has the molecular formula C12H16BrFN2O2S2 and a molecular weight of 383.31 g/mol. Its IUPAC name is 5-amino-3-bromo-2-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide.
| Compound Name | 5-amino-3-bromo-2-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 80726436 |
| Molecular Formula | C12H16BrFN2O2S2 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 5-amino-3-bromo-2-fluoro-N-[(2-methylthiolan-2-yl)methyl]benzenesulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2cc(N)cc(Br)c2F)CCCS1 |
| InChI | InChI=1S/C12H16BrFN2O2S2/c1-12(3-2-4-19-12)7-16-20(17,18)10-6-8(15)5-9(13)11(10)14/h5-6,16H,2-4,7,15H2,1H3 |
| InChIKey | FYXVLHZCMIIVDX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|