C13H20BrFN2O2S — CID 83142080
5-amino-3-bromo-2-fluoro-N-(2,3,3-trimethylbutyl)benzenesulfonamide (PubChem CID 83142080) has the molecular formula C13H20BrFN2O2S and a molecular weight of 367.28 g/mol. Its IUPAC name is 5-amino-3-bromo-2-fluoro-N-(2,3,3-trimethylbutyl)benzenesulfonamide.
| Compound Name | 5-amino-3-bromo-2-fluoro-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83142080 |
| Molecular Formula | C13H20BrFN2O2S |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 5-amino-3-bromo-2-fluoro-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(N)cc(Br)c1F)C(C)(C)C |
| InChI | InChI=1S/C13H20BrFN2O2S/c1-8(13(2,3)4)7-17-20(18,19)11-6-9(16)5-10(14)12(11)15/h5-6,8,17H,7,16H2,1-4H3 |
| InChIKey | HLBOUGZCHJEXHU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|