C13H20F2N2O3S — CID 66181065
5-amino-2,3-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide (PubChem CID 66181065) has the molecular formula C13H20F2N2O3S and a molecular weight of 322.38 g/mol. Its IUPAC name is 5-amino-2,3-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide.
| Compound Name | 5-amino-2,3-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66181065 |
| Molecular Formula | C13H20F2N2O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5-amino-2,3-difluoro-N-(2-hydroxy-2,4-dimethylpentyl)benzenesulfonamide |
| SMILES | CC(C)CC(C)(O)CNS(=O)(=O)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C13H20F2N2O3S/c1-8(2)6-13(3,18)7-17-21(19,20)11-5-9(16)4-10(14)12(11)15/h4-5,8,17-18H,6-7,16H2,1-3H3 |
| InChIKey | VWYXBRYEPMTXJV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|