C12H17F2N3O3S — CID 115355883
2-[(5-amino-2,3-difluorophenyl)sulfonylamino]-N-tert-butylacetamide (PubChem CID 115355883) has the molecular formula C12H17F2N3O3S and a molecular weight of 321.35 g/mol. Its IUPAC name is 2-[(5-amino-2,3-difluorophenyl)sulfonylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(5-amino-2,3-difluorophenyl)sulfonylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 115355883 |
| Molecular Formula | C12H17F2N3O3S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2-[(5-amino-2,3-difluorophenyl)sulfonylamino]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNS(=O)(=O)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C12H17F2N3O3S/c1-12(2,3)17-10(18)6-16-21(19,20)9-5-7(15)4-8(13)11(9)14/h4-5,16H,6,15H2,1-3H3,(H,17,18) |
| InChIKey | HATDVPJBMKKSLN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|