C9H11BrClN3O3S — CID 114274501
2-[(5-amino-3-bromo-2-chlorophenyl)sulfonylamino]-N-methylacetamide (PubChem CID 114274501) has the molecular formula C9H11BrClN3O3S and a molecular weight of 356.63 g/mol. Its IUPAC name is 2-[(5-amino-3-bromo-2-chlorophenyl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(5-amino-3-bromo-2-chlorophenyl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 114274501 |
| Molecular Formula | C9H11BrClN3O3S |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 2-[(5-amino-3-bromo-2-chlorophenyl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1cc(N)cc(Br)c1Cl |
| InChI | InChI=1S/C9H11BrClN3O3S/c1-13-8(15)4-14-18(16,17)7-3-5(12)2-6(10)9(7)11/h2-3,14H,4,12H2,1H3,(H,13,15) |
| InChIKey | CSHYQGDAWVGDMH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|