C11H14N4O3S — CID 64851480
2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-methylacetamide (PubChem CID 64851480) has the molecular formula C11H14N4O3S and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 64851480 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C11H14N4O3S/c1-13-11(16)6-15-19(17,18)10-5-14-9-3-2-7(12)4-8(9)10/h2-5,14-15H,6,12H2,1H3,(H,13,16) |
| InChIKey | UVAPDPMWZCLLCD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|