C11H15N3O3S — CID 64853230
5-amino-N-(3-hydroxypropyl)-1H-indole-3-sulfonamide (PubChem CID 64853230) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-amino-N-(3-hydroxypropyl)-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-(3-hydroxypropyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64853230 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-amino-N-(3-hydroxypropyl)-1H-indole-3-sulfonamide |
| SMILES | Nc1ccc2[nH]cc(S(=O)(=O)NCCCO)c2c1 |
| InChI | InChI=1S/C11H15N3O3S/c12-8-2-3-10-9(6-8)11(7-13-10)18(16,17)14-4-1-5-15/h2-3,6-7,13-15H,1,4-5,12H2 |
| InChIKey | OAOROMLNMRNFKF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|