C13H18N4O3S — CID 64850893
2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-propylacetamide (PubChem CID 64850893) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-propylacetamide.
| Compound Name | 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 64850893 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(5-amino-1H-indol-3-yl)sulfonylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNS(=O)(=O)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C13H18N4O3S/c1-2-5-15-13(18)8-17-21(19,20)12-7-16-11-4-3-9(14)6-10(11)12/h3-4,6-7,16-17H,2,5,8,14H2,1H3,(H,15,18) |
| InChIKey | BLFBMLLKKUKAHI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|