C13H12ClN3O2S2 — CID 64852859
5-amino-N-[(5-chlorothiophen-2-yl)methyl]-1H-indole-3-sulfonamide (PubChem CID 64852859) has the molecular formula C13H12ClN3O2S2 and a molecular weight of 341.85 g/mol. Its IUPAC name is 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-1H-indole-3-sulfonamide.
| Compound Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 64852859 |
| Molecular Formula | C13H12ClN3O2S2 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 5-amino-N-[(5-chlorothiophen-2-yl)methyl]-1H-indole-3-sulfonamide |
| SMILES | Nc1ccc2[nH]cc(S(=O)(=O)NCc3ccc(Cl)s3)c2c1 |
| InChI | InChI=1S/C13H12ClN3O2S2/c14-13-4-2-9(20-13)6-17-21(18,19)12-7-16-11-3-1-8(15)5-10(11)12/h1-5,7,16-17H,6,15H2 |
| InChIKey | RQZFYQOTQJWDFN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|