C11H14N4O4S — CID 83202971
2-[(6-amino-1H-indol-3-yl)sulfonylamino]ethyl carbamate (PubChem CID 83202971) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-[(6-amino-1H-indol-3-yl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(6-amino-1H-indol-3-yl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83202971 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[(6-amino-1H-indol-3-yl)sulfonylamino]ethyl carbamate |
| SMILES | NC(=O)OCCNS(=O)(=O)c1c[nH]c2cc(N)ccc12 |
| InChI | InChI=1S/C11H14N4O4S/c12-7-1-2-8-9(5-7)14-6-10(8)20(17,18)15-3-4-19-11(13)16/h1-2,5-6,14-15H,3-4,12H2,(H2,13,16) |
| InChIKey | FPQCKPRXWBFLIT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|