C13H17N3O2S — CID 66000332
6-amino-N-(cyclobutylmethyl)-1H-indole-3-sulfonamide (PubChem CID 66000332) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-amino-N-(cyclobutylmethyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-amino-N-(cyclobutylmethyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 66000332 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-amino-N-(cyclobutylmethyl)-1H-indole-3-sulfonamide |
| SMILES | Nc1ccc2c(S(=O)(=O)NCC3CCC3)c[nH]c2c1 |
| InChI | InChI=1S/C13H17N3O2S/c14-10-4-5-11-12(6-10)15-8-13(11)19(17,18)16-7-9-2-1-3-9/h4-6,8-9,15-16H,1-3,7,14H2 |
| InChIKey | QWKZRGWYGVUHCR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|