C11H11F4N3O2S — CID 106289403
6-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indole-3-sulfonamide (PubChem CID 106289403) has the molecular formula C11H11F4N3O2S and a molecular weight of 325.29 g/mol. Its IUPAC name is 6-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 106289403 |
| Molecular Formula | C11H11F4N3O2S |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 6-amino-N-(2,2,3,3-tetrafluoropropyl)-1H-indole-3-sulfonamide |
| SMILES | Nc1ccc2c(S(=O)(=O)NCC(F)(F)C(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C11H11F4N3O2S/c12-10(13)11(14,15)5-18-21(19,20)9-4-17-8-3-6(16)1-2-7(8)9/h1-4,10,17-18H,5,16H2 |
| InChIKey | JTRKJWHWNNZZLK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|