C12H12F3N3O2S — CID 106208511
6-amino-N-[1-(trifluoromethyl)cyclopropyl]-1H-indole-3-sulfonamide (PubChem CID 106208511) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is 6-amino-N-[1-(trifluoromethyl)cyclopropyl]-1H-indole-3-sulfonamide.
| Compound Name | 6-amino-N-[1-(trifluoromethyl)cyclopropyl]-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 106208511 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 6-amino-N-[1-(trifluoromethyl)cyclopropyl]-1H-indole-3-sulfonamide |
| SMILES | Nc1ccc2c(S(=O)(=O)NC3(C(F)(F)F)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C12H12F3N3O2S/c13-12(14,15)11(3-4-11)18-21(19,20)10-6-17-9-5-7(16)1-2-8(9)10/h1-2,5-6,17-18H,3-4,16H2 |
| InChIKey | IIAMJNXNTBSXOR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|