C10H9BrF4N2O2S — CID 106208595
5-amino-3-bromo-2-fluoro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 106208595) has the molecular formula C10H9BrF4N2O2S and a molecular weight of 377.16 g/mol. Its IUPAC name is 5-amino-3-bromo-2-fluoro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 5-amino-3-bromo-2-fluoro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106208595 |
| Molecular Formula | C10H9BrF4N2O2S |
| Molecular Weight | 377.16 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 5-amino-3-bromo-2-fluoro-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | Nc1cc(Br)c(F)c(S(=O)(=O)NC2(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C10H9BrF4N2O2S/c11-6-3-5(16)4-7(8(6)12)20(18,19)17-9(1-2-9)10(13,14)15/h3-4,17H,1-2,16H2 |
| InChIKey | MKKUVGGLACEOBI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|