C12H14BrF3N2O2S — CID 106218751
2-bromo-4-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 106218751) has the molecular formula C12H14BrF3N2O2S and a molecular weight of 387.22 g/mol. Its IUPAC name is 2-bromo-4-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106218751 |
| Molecular Formula | C12H14BrF3N2O2S |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 2-bromo-4-(methylaminomethyl)-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NC2(C(F)(F)F)CC2)c(Br)c1 |
| InChI | InChI=1S/C12H14BrF3N2O2S/c1-17-7-8-2-3-10(9(13)6-8)21(19,20)18-11(4-5-11)12(14,15)16/h2-3,6,17-18H,4-5,7H2,1H3 |
| InChIKey | KHXXLXJXJXKZMJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |