C11H11BrF3NO2S — CID 106214877
4-bromo-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide (PubChem CID 106214877) has the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106214877 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 4-bromo-3-methyl-N-[1-(trifluoromethyl)cyclopropyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)ccc1Br |
| InChI | InChI=1S/C11H11BrF3NO2S/c1-7-6-8(2-3-9(7)12)19(17,18)16-10(4-5-10)11(13,14)15/h2-3,6,16H,4-5H2,1H3 |
| InChIKey | BKTJJBFIDXQAHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |