C11H9BrF3NO4S — CID 106209132
2-bromo-5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid (PubChem CID 106209132) has the molecular formula C11H9BrF3NO4S and a molecular weight of 388.16 g/mol. Its IUPAC name is 2-bromo-5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid.
| Compound Name | 2-bromo-5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106209132 |
| Molecular Formula | C11H9BrF3NO4S |
| Molecular Weight | 388.16 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 2-bromo-5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)ccc1Br |
| InChI | InChI=1S/C11H9BrF3NO4S/c12-8-2-1-6(5-7(8)9(17)18)21(19,20)16-10(3-4-10)11(13,14)15/h1-2,5,16H,3-4H2,(H,17,18) |
| InChIKey | SNVZUBAZCJAIRR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |