C11H11F3N2O4S — CID 106208573
4-amino-2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid (PubChem CID 106208573) has the molecular formula C11H11F3N2O4S and a molecular weight of 324.28 g/mol. Its IUPAC name is 4-amino-2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid.
| Compound Name | 4-amino-2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106208573 |
| Molecular Formula | C11H11F3N2O4S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-amino-2-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)NC2(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C11H11F3N2O4S/c12-11(13,14)10(3-4-10)16-21(19,20)8-5-6(15)1-2-7(8)9(17)18/h1-2,5,16H,3-4,15H2,(H,17,18) |
| InChIKey | NEZLKJPGKYXFBI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|