C11H11F3N2O2 — CID 106219376
5-amino-2-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid (PubChem CID 106219376) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 5-amino-2-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid.
| Compound Name | 5-amino-2-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
|---|---|
| PubChem CID | 106219376 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 5-amino-2-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
| SMILES | Nc1ccc(NC2(C(F)(F)F)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-11(13,14)10(3-4-10)16-8-2-1-6(15)5-7(8)9(17)18/h1-2,5,16H,3-4,15H2,(H,17,18) |
| InChIKey | WSETZWXUMWFTKF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|