C11H8F4N2O4 — CID 106213880
2-fluoro-5-nitro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid (PubChem CID 106213880) has the molecular formula C11H8F4N2O4 and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-fluoro-5-nitro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid.
| Compound Name | 2-fluoro-5-nitro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
|---|---|
| PubChem CID | 106213880 |
| Molecular Formula | C11H8F4N2O4 |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-fluoro-5-nitro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(NC2(C(F)(F)F)CC2)cc1F |
| InChI | InChI=1S/C11H8F4N2O4/c12-6-4-7(16-10(1-2-10)11(13,14)15)8(17(20)21)3-5(6)9(18)19/h3-4,16H,1-2H2,(H,18,19) |
| InChIKey | VYXYVEMKWOAIQM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|