C10H10F4N2O2S — CID 106214896
3-fluoro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzenesulfonamide (PubChem CID 106214896) has the molecular formula C10H10F4N2O2S and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-fluoro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106214896 |
| Molecular Formula | C10H10F4N2O2S |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-fluoro-4-[[1-(trifluoromethyl)cyclopropyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC2(C(F)(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C10H10F4N2O2S/c11-7-5-6(19(15,17)18)1-2-8(7)16-9(3-4-9)10(12,13)14/h1-2,5,16H,3-4H2,(H2,15,17,18) |
| InChIKey | FNZHSYLSSXDDRW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |