C14H22FN3O2S — CID 115309057
4-[[1-(aminomethyl)-2-methylcyclohexyl]amino]-3-fluorobenzenesulfonamide (PubChem CID 115309057) has the molecular formula C14H22FN3O2S and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-[[1-(aminomethyl)-2-methylcyclohexyl]amino]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[[1-(aminomethyl)-2-methylcyclohexyl]amino]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115309057 |
| Molecular Formula | C14H22FN3O2S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-[[1-(aminomethyl)-2-methylcyclohexyl]amino]-3-fluorobenzenesulfonamide |
| SMILES | CC1CCCCC1(CN)Nc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C14H22FN3O2S/c1-10-4-2-3-7-14(10,9-16)18-13-6-5-11(8-12(13)15)21(17,19)20/h5-6,8,10,18H,2-4,7,9,16H2,1H3,(H2,17,19,20) |
| InChIKey | WMWHAOAZYLBQPF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |